C15H21N5O — CID 119856901
3-piperidin-3-yl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide (PubChem CID 119856901) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide.
| Compound Name | 3-piperidin-3-yl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide |
|---|---|
| PubChem CID | 119856901 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-piperidin-3-yl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide |
| SMILES | CC(CC(=O)Nc1nnc2ccccn12)C1CCCNC1 |
| InChI | InChI=1S/C15H21N5O/c1-11(12-5-4-7-16-10-12)9-14(21)17-15-19-18-13-6-2-3-8-20(13)15/h2-3,6,8,11-12,16H,4-5,7,9-10H2,1H3,(H,17,19,21) |
| InChIKey | CETVNIZHOYGUMV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |