C13H15N3O6S — CID 11976848
4-amino-2-[(4-amino-1-carboxy-4-sulfanylidenebutyl)carbamoyloxy]benzoic acid (PubChem CID 11976848) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 4-amino-2-[(4-amino-1-carboxy-4-sulfanylidenebutyl)carbamoyloxy]benzoic acid.
| Compound Name | 4-amino-2-[(4-amino-1-carboxy-4-sulfanylidenebutyl)carbamoyloxy]benzoic acid |
|---|---|
| PubChem CID | 11976848 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-amino-2-[(4-amino-1-carboxy-4-sulfanylidenebutyl)carbamoyloxy]benzoic acid |
| SMILES | NC(=S)CCC(NC(=O)Oc1cc(N)ccc1C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H15N3O6S/c14-6-1-2-7(11(17)18)9(5-6)22-13(21)16-8(12(19)20)3-4-10(15)23/h1-2,5,8H,3-4,14H2,(H2,15,23)(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | LXFVKRJUTWJEMK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|