C12H24O4S2 — CID 11977002
(1R)-1-[(4R,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 11977002) has the molecular formula C12H24O4S2 and a molecular weight of 296.45 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(4R,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11977002 |
| Molecular Formula | C12H24O4S2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | CCSC(SCC)[C@H]1OC(C)(C)O[C@@H]1[C@H](O)CO |
| InChI | InChI=1S/C12H24O4S2/c1-5-17-11(18-6-2)10-9(8(14)7-13)15-12(3,4)16-10/h8-11,13-14H,5-7H2,1-4H3/t8-,9-,10+/m1/s1 |
| InChIKey | LPWNOTKGDBWAQD-BBBLOLIVSA-N |
| XLogP | 1.69 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|