C20H30ClN3O — CID 119774521
N-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119774521) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is N-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119774521 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | Cc1cccc2[nH]cc(CCNC(=O)CC(C)C3CCCNC3)c12.Cl |
| InChI | InChI=1S/C20H29N3O.ClH/c1-14-5-3-7-18-20(14)17(13-23-18)8-10-22-19(24)11-15(2)16-6-4-9-21-12-16;/h3,5,7,13,15-16,21,23H,4,6,8-12H2,1-2H3,(H,22,24);1H |
| InChIKey | FCNJVPMGXLFPCD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |