C20H35Cl2N3O — CID 119853418
N-[2-(N-ethyl-2-methylanilino)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119853418) has the molecular formula C20H35Cl2N3O and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[2-(N-ethyl-2-methylanilino)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119853418 |
| Molecular Formula | C20H35Cl2N3O |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CCN(CCNC(=O)CC(C)C1CCCNC1)c1ccccc1C.Cl.Cl |
| InChI | InChI=1S/C20H33N3O.2ClH/c1-4-23(19-10-6-5-8-16(19)2)13-12-22-20(24)14-17(3)18-9-7-11-21-15-18;;/h5-6,8,10,17-18,21H,4,7,9,11-15H2,1-3H3,(H,22,24);2*1H |
| InChIKey | DUUWUYKAPNVIFE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |