C20H29FN2O — CID 119808014
1-[2-(3-fluorophenyl)-3-methylpyrrolidin-1-yl]-3-piperidin-4-ylbutan-1-one (PubChem CID 119808014) has the molecular formula C20H29FN2O and a molecular weight of 332.46 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)-3-methylpyrrolidin-1-yl]-3-piperidin-4-ylbutan-1-one.
| Compound Name | 1-[2-(3-fluorophenyl)-3-methylpyrrolidin-1-yl]-3-piperidin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 119808014 |
| Molecular Formula | C20H29FN2O |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1-[2-(3-fluorophenyl)-3-methylpyrrolidin-1-yl]-3-piperidin-4-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCC(C)C1c1cccc(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C20H29FN2O/c1-14-8-11-23(20(14)17-4-3-5-18(21)13-17)19(24)12-15(2)16-6-9-22-10-7-16/h3-5,13-16,20,22H,6-12H2,1-2H3 |
| InChIKey | VGCBHVRNLAFCNR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |