C18H26F2N2O4 — CID 119810510
N-[[2-(difluoromethoxy)-4-propoxyphenyl]methyl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119810510) has the molecular formula C18H26F2N2O4 and a molecular weight of 372.41 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-4-propoxyphenyl]methyl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)-4-propoxyphenyl]methyl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119810510 |
| Molecular Formula | C18H26F2N2O4 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-[[2-(difluoromethoxy)-4-propoxyphenyl]methyl]-4-methoxypiperidine-4-carboxamide |
| SMILES | CCCOc1ccc(CNC(=O)C2(OC)CCNCC2)c(OC(F)F)c1 |
| InChI | InChI=1S/C18H26F2N2O4/c1-3-10-25-14-5-4-13(15(11-14)26-17(19)20)12-22-16(23)18(24-2)6-8-21-9-7-18/h4-5,11,17,21H,3,6-10,12H2,1-2H3,(H,22,23) |
| InChIKey | FNXXZCXMFXBCCY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |