C18H20Cl2N2O — CID 119813926
N-[[2-(2,4-dichlorophenyl)phenyl]methyl]-4-(methylamino)butanamide (PubChem CID 119813926) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[[2-(2,4-dichlorophenyl)phenyl]methyl]-4-(methylamino)butanamide.
| Compound Name | N-[[2-(2,4-dichlorophenyl)phenyl]methyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119813926 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[[2-(2,4-dichlorophenyl)phenyl]methyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCc1ccccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O/c1-21-10-4-7-18(23)22-12-13-5-2-3-6-15(13)16-9-8-14(19)11-17(16)20/h2-3,5-6,8-9,11,21H,4,7,10,12H2,1H3,(H,22,23) |
| InChIKey | SGVXUBJTJTYPIS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|