C30H43NO5Si — CID 11983778
benzyl (2S)-4-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 11983778) has the molecular formula C30H43NO5Si and a molecular weight of 525.76 g/mol. Its IUPAC name is benzyl (2S)-4-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | benzyl (2S)-4-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 11983778 |
| Molecular Formula | C30H43NO5Si |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | benzyl (2S)-4-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=C(Cc1ccccc1O[Si](C)(C)C(C)(C)C)C[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H43NO5Si/c1-22(19-24-17-13-14-18-26(24)36-37(8,9)30(5,6)7)20-25(31-28(33)35-29(2,3)4)27(32)34-21-23-15-11-10-12-16-23/h10-18,25H,1,19-21H2,2-9H3,(H,31,33)/t25-/m0/s1 |
| InChIKey | NBKSYWQQCMWVAE-VWLOTQADSA-N |
| XLogP | 7.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|