C22H34FeN4-6 — CID 11984861
1-(cyclopenta-2,4-dien-1-ylmethyl)-8-(cyclopentylmethyl)-1,4,8,11-tetrazacyclotetradecane;iron (PubChem CID 11984861) has the molecular formula C22H34FeN4-6 and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-(cyclopenta-2,4-dien-1-ylmethyl)-8-(cyclopentylmethyl)-1,4,8,11-tetrazacyclotetradecane;iron.
| Compound Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)-8-(cyclopentylmethyl)-1,4,8,11-tetrazacyclotetradecane;iron |
|---|---|
| PubChem CID | 11984861 |
| Molecular Formula | C22H34FeN4-6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)-8-(cyclopentylmethyl)-1,4,8,11-tetrazacyclotetradecane;iron |
| SMILES | [Fe].c1cc[c-](CN2CCCNCCN(C[c-]3[cH-][cH-][cH-][cH-]3)CCCNCC2)c1 |
| InChI | InChI=1S/C22H34N4.Fe/c1-2-8-21(7-1)19-25-15-5-11-24-14-18-26(16-6-12-23-13-17-25)20-22-9-3-4-10-22;/h1-4,7-10,23-24H,5-6,11-20H2;/q-6; |
| InChIKey | HUYDALDMIHLDBR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|