C19H28ClN3O — CID 119879572
3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclopentane-1-carboxamide (PubChem CID 119879572) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is 3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119879572 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclopentane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCC2CCN(Cc3ccccc3Cl)CC2)C1 |
| InChI | InChI=1S/C19H28ClN3O/c20-18-4-2-1-3-16(18)13-23-9-7-14(8-10-23)12-22-19(24)15-5-6-17(21)11-15/h1-4,14-15,17H,5-13,21H2,(H,22,24) |
| InChIKey | XOQGRUCXVATGNY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |