C20H30ClN3O — CID 119879576
3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclohexane-1-carboxamide (PubChem CID 119879576) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is 3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119879576 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 3-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)NCC2CCN(Cc3ccccc3Cl)CC2)C1 |
| InChI | InChI=1S/C20H30ClN3O/c21-19-7-2-1-4-17(19)14-24-10-8-15(9-11-24)13-23-20(25)16-5-3-6-18(22)12-16/h1-2,4,7,15-16,18H,3,5-6,8-14,22H2,(H,23,25) |
| InChIKey | MDDXWVAGZAPZJL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |