C18H28ClN3O — CID 120565429
4-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]pentanamide (PubChem CID 120565429) has the molecular formula C18H28ClN3O and a molecular weight of 337.89 g/mol. Its IUPAC name is 4-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]pentanamide.
| Compound Name | 4-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 120565429 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-amino-N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]pentanamide |
| SMILES | CC(N)CCC(=O)NCC1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H28ClN3O/c1-14(20)6-7-18(23)21-12-15-8-10-22(11-9-15)13-16-4-2-3-5-17(16)19/h2-5,14-15H,6-13,20H2,1H3,(H,21,23) |
| InChIKey | NGBSPYKZYIMJMM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |