C18H23ClN4O — CID 136524248
N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpyrazole-3-carboxamide (PubChem CID 136524248) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136524248 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)NCC1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClN4O/c1-22-17(6-9-21-22)18(24)20-12-14-7-10-23(11-8-14)13-15-4-2-3-5-16(15)19/h2-6,9,14H,7-8,10-13H2,1H3,(H,20,24) |
| InChIKey | HZGLLVXTZZIAHR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |