C16H29Cl2N3O2S — CID 119880751
N-methyl-4-(methylamino)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride (PubChem CID 119880751) has the molecular formula C16H29Cl2N3O2S and a molecular weight of 398.40 g/mol. Its IUPAC name is N-methyl-4-(methylamino)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride.
| Compound Name | N-methyl-4-(methylamino)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119880751 |
| Molecular Formula | C16H29Cl2N3O2S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-methyl-4-(methylamino)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)N(C)CC(c1cccs1)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C16H27N3O2S.2ClH/c1-17-7-3-6-16(20)18(2)13-14(15-5-4-12-22-15)19-8-10-21-11-9-19;;/h4-5,12,14,17H,3,6-11,13H2,1-2H3;2*1H |
| InChIKey | CUSRPHWJZFZIEE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|