C14H25N3O3S2 — CID 96998377
N-[2-[methyl-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]ethyl]methanesulfonamide (PubChem CID 96998377) has the molecular formula C14H25N3O3S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is N-[2-[methyl-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[methyl-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 96998377 |
| Molecular Formula | C14H25N3O3S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[2-[methyl-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]ethyl]methanesulfonamide |
| SMILES | CN(CCNS(C)(=O)=O)C[C@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C14H25N3O3S2/c1-16(6-5-15-22(2,18)19)12-13(14-4-3-11-21-14)17-7-9-20-10-8-17/h3-4,11,13,15H,5-10,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | DQKPESVJHNRCIZ-CYBMUJFWSA-N |
| XLogP | 0.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |