C17H28N2O2S — CID 95767529
(2S)-N-methyl-2-morpholin-4-yl-N-(oxan-4-ylmethyl)-2-thiophen-2-ylethanamine (PubChem CID 95767529) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is (2S)-N-methyl-2-morpholin-4-yl-N-(oxan-4-ylmethyl)-2-thiophen-2-ylethanamine.
| Compound Name | (2S)-N-methyl-2-morpholin-4-yl-N-(oxan-4-ylmethyl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 95767529 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2S)-N-methyl-2-morpholin-4-yl-N-(oxan-4-ylmethyl)-2-thiophen-2-ylethanamine |
| SMILES | CN(CC1CCOCC1)C[C@@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H28N2O2S/c1-18(13-15-4-8-20-9-5-15)14-16(17-3-2-12-22-17)19-6-10-21-11-7-19/h2-3,12,15-16H,4-11,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | DMIFOBGBCWMDKF-INIZCTEOSA-N |
| XLogP | 2.48 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |