C16H28N2O2S — CID 97085403
(2S)-N-methyl-2-morpholin-4-yl-N-(2-propan-2-yloxyethyl)-2-thiophen-2-ylethanamine (PubChem CID 97085403) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is (2S)-N-methyl-2-morpholin-4-yl-N-(2-propan-2-yloxyethyl)-2-thiophen-2-ylethanamine.
| Compound Name | (2S)-N-methyl-2-morpholin-4-yl-N-(2-propan-2-yloxyethyl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 97085403 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (2S)-N-methyl-2-morpholin-4-yl-N-(2-propan-2-yloxyethyl)-2-thiophen-2-ylethanamine |
| SMILES | CC(C)OCCN(C)C[C@@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C16H28N2O2S/c1-14(2)20-11-6-17(3)13-15(16-5-4-12-21-16)18-7-9-19-10-8-18/h4-5,12,14-15H,6-11,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | PDFCTEQFMIDYSQ-HNNXBMFYSA-N |
| XLogP | 2.48 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |