C13H23Cl2N3O2S — CID 119880785
2-amino-N-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide;dihydrochloride (PubChem CID 119880785) has the molecular formula C13H23Cl2N3O2S and a molecular weight of 356.32 g/mol. Its IUPAC name is 2-amino-N-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119880785 |
| Molecular Formula | C13H23Cl2N3O2S |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-amino-N-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide;dihydrochloride |
| SMILES | CN(CC(c1cccs1)N1CCOCC1)C(=O)CN.Cl.Cl |
| InChI | InChI=1S/C13H21N3O2S.2ClH/c1-15(13(17)9-14)10-11(12-3-2-8-19-12)16-4-6-18-7-5-16;;/h2-3,8,11H,4-7,9-10,14H2,1H3;2*1H |
| InChIKey | XQHXARXNKIXWLN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |