C12H18N2O3S — CID 121209627
2-amino-4-morpholin-4-yl-4-thiophen-2-ylbutanoic acid (PubChem CID 121209627) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-amino-4-morpholin-4-yl-4-thiophen-2-ylbutanoic acid.
| Compound Name | 2-amino-4-morpholin-4-yl-4-thiophen-2-ylbutanoic acid |
|---|---|
| PubChem CID | 121209627 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-amino-4-morpholin-4-yl-4-thiophen-2-ylbutanoic acid |
| SMILES | NC(CC(c1cccs1)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C12H18N2O3S/c13-9(12(15)16)8-10(11-2-1-7-18-11)14-3-5-17-6-4-14/h1-2,7,9-10H,3-6,8,13H2,(H,15,16) |
| InChIKey | GSHXBMCPXCAKCG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |