C15H22Cl3N3O — CID 119887171
(4-amino-2-chlorophenyl)-(4-cyclobutylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119887171) has the molecular formula C15H22Cl3N3O and a molecular weight of 366.72 g/mol. Its IUPAC name is (4-amino-2-chlorophenyl)-(4-cyclobutylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (4-amino-2-chlorophenyl)-(4-cyclobutylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119887171 |
| Molecular Formula | C15H22Cl3N3O |
| Molecular Weight | 366.72 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (4-amino-2-chlorophenyl)-(4-cyclobutylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C(=O)N2CCN(C3CCC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O.2ClH/c16-14-10-11(17)4-5-13(14)15(20)19-8-6-18(7-9-19)12-2-1-3-12;;/h4-5,10,12H,1-3,6-9,17H2;2*1H |
| InChIKey | POHUNYHHMRJCMQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|