C33H43NO8 — CID 11988786
bis(4-methylphenyl) (2S,3S)-2,3-dihydroxybutanedioate;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol (PubChem CID 11988786) has the molecular formula C33H43NO8 and a molecular weight of 581.71 g/mol. Its IUPAC name is bis(4-methylphenyl) (2S,3S)-2,3-dihydroxybutanedioate;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol.
| Compound Name | bis(4-methylphenyl) (2S,3S)-2,3-dihydroxybutanedioate;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 11988786 |
| Molecular Formula | C33H43NO8 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | bis(4-methylphenyl) (2S,3S)-2,3-dihydroxybutanedioate;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol |
| SMILES | CC[C@](O)(c1cccc(OC)c1)[C@H](C)CN(C)C.Cc1ccc(OC(=O)[C@@H](O)[C@H](O)C(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18O6.C15H25NO2/c1-11-3-7-13(8-4-11)23-17(21)15(19)16(20)18(22)24-14-9-5-12(2)6-10-14;1-6-15(17,12(2)11-16(3)4)13-8-7-9-14(10-13)18-5/h3-10,15-16,19-20H,1-2H3;7-10,12,17H,6,11H2,1-5H3/t15-,16-;12-,15-/m01/s1 |
| InChIKey | ZVWZPHKVQFQIHQ-WXXSCKPZSA-N |
| XLogP | 4.03 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|