C24H33NO6 — CID 160584558
2-acetyloxybenzoic acid;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol (PubChem CID 160584558) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol.
| Compound Name | 2-acetyloxybenzoic acid;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 160584558 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 2-acetyloxybenzoic acid;(2R,3R)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.CC[C@](O)(c1cccc(OC)c1)[C@H](C)CN(C)C |
| InChI | InChI=1S/C15H25NO2.C9H8O4/c1-6-15(17,12(2)11-16(3)4)13-8-7-9-14(10-13)18-5;1-6(10)13-8-5-3-2-4-7(8)9(11)12/h7-10,12,17H,6,11H2,1-5H3;2-5H,1H3,(H,11,12)/t12-,15-;/m1./s1 |
| InChIKey | RCFLYKKOASIBHC-XRZFDKQNSA-N |
| XLogP | 3.80 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|