C24H28F3N3O2 — CID 11989579
N-[2-(dimethylamino)ethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-3-carboxamide (PubChem CID 11989579) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 11989579 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-3-carboxamide |
| SMILES | CN(C)CCNC(=O)C1COC2c3cc(C(F)(F)F)ccc3NC(c3ccccc3)C2C1 |
| InChI | InChI=1S/C24H28F3N3O2/c1-30(2)11-10-28-23(31)16-12-19-21(15-6-4-3-5-7-15)29-20-9-8-17(24(25,26)27)13-18(20)22(19)32-14-16/h3-9,13,16,19,21-22,29H,10-12,14H2,1-2H3,(H,28,31) |
| InChIKey | TUIRRCVJTAMXNM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |