C15H25Cl2N3O2 — CID 119899958
N-(3-methyl-2-pyridin-3-ylbutyl)morpholine-3-carboxamide;dihydrochloride (PubChem CID 119899958) has the molecular formula C15H25Cl2N3O2 and a molecular weight of 350.29 g/mol. Its IUPAC name is N-(3-methyl-2-pyridin-3-ylbutyl)morpholine-3-carboxamide;dihydrochloride.
| Compound Name | N-(3-methyl-2-pyridin-3-ylbutyl)morpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119899958 |
| Molecular Formula | C15H25Cl2N3O2 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-(3-methyl-2-pyridin-3-ylbutyl)morpholine-3-carboxamide;dihydrochloride |
| SMILES | CC(C)C(CNC(=O)C1COCCN1)c1cccnc1.Cl.Cl |
| InChI | InChI=1S/C15H23N3O2.2ClH/c1-11(2)13(12-4-3-5-16-8-12)9-18-15(19)14-10-20-7-6-17-14;;/h3-5,8,11,13-14,17H,6-7,9-10H2,1-2H3,(H,18,19);2*1H |
| InChIKey | NUSLEVGPZSDZIX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |