C19H31Cl2N3O — CID 119899980
N-(3-methyl-2-pyridin-3-ylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119899980) has the molecular formula C19H31Cl2N3O and a molecular weight of 388.38 g/mol. Its IUPAC name is N-(3-methyl-2-pyridin-3-ylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-(3-methyl-2-pyridin-3-ylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119899980 |
| Molecular Formula | C19H31Cl2N3O |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-(3-methyl-2-pyridin-3-ylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CC(C)C(CNC(=O)C1CC2CCCCC2N1)c1cccnc1.Cl.Cl |
| InChI | InChI=1S/C19H29N3O.2ClH/c1-13(2)16(15-7-5-9-20-11-15)12-21-19(23)18-10-14-6-3-4-8-17(14)22-18;;/h5,7,9,11,13-14,16-18,22H,3-4,6,8,10,12H2,1-2H3,(H,21,23);2*1H |
| InChIKey | FLPNQQZRSOYBPF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |