C43H42N6OSi — CID 11990915
2-[[2-[10,20-bis(4-methylphenyl)-23,24-dihydroporphyrin-5-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 11990915) has the molecular formula C43H42N6OSi and a molecular weight of 686.94 g/mol. Its IUPAC name is 2-[[2-[10,20-bis(4-methylphenyl)-23,24-dihydroporphyrin-5-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[10,20-bis(4-methylphenyl)-23,24-dihydroporphyrin-5-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11990915 |
| Molecular Formula | C43H42N6OSi |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | 2-[[2-[10,20-bis(4-methylphenyl)-23,24-dihydroporphyrin-5-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1ccc(-c2c3nc(c(-c4nccn4COCC[Si](C)(C)C)c4nc(c(-c5ccc(C)cc5)c5ccc(cc6ccc2[nH]6)[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C43H42N6OSi/c1-28-6-10-30(11-7-28)40-34-16-14-32(45-34)26-33-15-17-35(46-33)41(31-12-8-29(2)9-13-31)37-19-21-39(48-37)42(38-20-18-36(40)47-38)43-44-22-23-49(43)27-50-24-25-51(3,4)5/h6-23,26,45-46H,24-25,27H2,1-5H3/b32-26-,33-26-,40-34-,40-36-,41-35-,41-37-,42-38+,42-39+ |
| InChIKey | ICJPXWLKTKISNI-XOVOIWBPSA-N |
| XLogP | 10.78 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|