C8H20ClN3O2S — CID 119910084
N-[2-(3-aminopiperidin-1-yl)ethyl]methanesulfonamide;hydrochloride (PubChem CID 119910084) has the molecular formula C8H20ClN3O2S and a molecular weight of 257.79 g/mol. Its IUPAC name is N-[2-(3-aminopiperidin-1-yl)ethyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-(3-aminopiperidin-1-yl)ethyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119910084 |
| Molecular Formula | C8H20ClN3O2S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[2-(3-aminopiperidin-1-yl)ethyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)NCCN1CCCC(N)C1.Cl |
| InChI | InChI=1S/C8H19N3O2S.ClH/c1-14(12,13)10-4-6-11-5-2-3-8(9)7-11;/h8,10H,2-7,9H2,1H3;1H |
| InChIKey | QEKVZCICYFMXLO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |