C10H22N2O2S2 — CID 97238803
N-[2-[(3S)-3-methylsulfanylazepan-1-yl]ethyl]methanesulfonamide (PubChem CID 97238803) has the molecular formula C10H22N2O2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is N-[2-[(3S)-3-methylsulfanylazepan-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3S)-3-methylsulfanylazepan-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 97238803 |
| Molecular Formula | C10H22N2O2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[2-[(3S)-3-methylsulfanylazepan-1-yl]ethyl]methanesulfonamide |
| SMILES | CS[C@H]1CCCCN(CCNS(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H22N2O2S2/c1-15-10-5-3-4-7-12(9-10)8-6-11-16(2,13)14/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | OVFHWMPZQVRHHZ-JTQLQIEISA-N |
| XLogP | 0.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |