C14H27N3O2S — CID 97238808
N-[2-[(4aR,8aR)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]ethyl]methanesulfonamide (PubChem CID 97238808) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is N-[2-[(4aR,8aR)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4aR,8aR)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 97238808 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[2-[(4aR,8aR)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1CC[C@@H]2[C@H](CCCN2C2CC2)C1 |
| InChI | InChI=1S/C14H27N3O2S/c1-20(18,19)15-7-10-16-9-6-14-12(11-16)3-2-8-17(14)13-4-5-13/h12-15H,2-11H2,1H3/t12-,14-/m1/s1 |
| InChIKey | BGPPRHXOMFBJTR-TZMCWYRMSA-N |
| XLogP | 0.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |