C34H23F5N4O8 — CID 11991506
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-oxo-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]purin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 11991506) has the molecular formula C34H23F5N4O8 and a molecular weight of 710.57 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-oxo-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]purin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-oxo-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]purin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11991506 |
| Molecular Formula | C34H23F5N4O8 |
| Molecular Weight | 710.57 g/mol |
| Exact Mass | 710.14 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-oxo-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]purin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(=O)n(/C(F)=C(\F)C(F)(F)F)cnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H23F5N4O8/c35-26(34(37,38)39)27(36)42-18-41-28-23(29(42)44)40-17-43(28)30-25(51-33(47)21-14-8-3-9-15-21)24(50-32(46)20-12-6-2-7-13-20)22(49-30)16-48-31(45)19-10-4-1-5-11-19/h1-15,17-18,22,24-25,30H,16H2/b27-26-/t22-,24-,25-,30-/m1/s1 |
| InChIKey | NLIMNLZTUQRMOB-YEYYFFTCSA-N |
| XLogP | 5.43 |
| TPSA | 140.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|