C17H23F3N2OS — CID 119940303
2-thiomorpholin-3-yl-N-[3-[3-(trifluoromethyl)phenyl]butyl]acetamide (PubChem CID 119940303) has the molecular formula C17H23F3N2OS and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-thiomorpholin-3-yl-N-[3-[3-(trifluoromethyl)phenyl]butyl]acetamide.
| Compound Name | 2-thiomorpholin-3-yl-N-[3-[3-(trifluoromethyl)phenyl]butyl]acetamide |
|---|---|
| PubChem CID | 119940303 |
| Molecular Formula | C17H23F3N2OS |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-thiomorpholin-3-yl-N-[3-[3-(trifluoromethyl)phenyl]butyl]acetamide |
| SMILES | CC(CCNC(=O)CC1CSCCN1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2OS/c1-12(13-3-2-4-14(9-13)17(18,19)20)5-6-22-16(23)10-15-11-24-8-7-21-15/h2-4,9,12,15,21H,5-8,10-11H2,1H3,(H,22,23) |
| InChIKey | UWNATUUELWCCBN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |