C29H30O4 — CID 11995778
2-[4-[3-hydroxy-5-phenyl-3-(2-phenylethyl)pent-1-ynyl]phenoxy]-2-methylpropanoic acid (PubChem CID 11995778) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[4-[3-hydroxy-5-phenyl-3-(2-phenylethyl)pent-1-ynyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-hydroxy-5-phenyl-3-(2-phenylethyl)pent-1-ynyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11995778 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[4-[3-hydroxy-5-phenyl-3-(2-phenylethyl)pent-1-ynyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(C#CC(O)(CCc2ccccc2)CCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H30O4/c1-28(2,27(30)31)33-26-15-13-25(14-16-26)19-22-29(32,20-17-23-9-5-3-6-10-23)21-18-24-11-7-4-8-12-24/h3-16,32H,17-18,20-21H2,1-2H3,(H,30,31) |
| InChIKey | WHDGVXRAZGLUGW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|