C29H28O3 — CID 143282503
2-methyl-2-[4-[(Z)-5-phenyl-3-(2-phenylethyl)pent-3-en-1-ynyl]phenoxy]propanoic acid (PubChem CID 143282503) has the molecular formula C29H28O3 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-methyl-2-[4-[(Z)-5-phenyl-3-(2-phenylethyl)pent-3-en-1-ynyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[(Z)-5-phenyl-3-(2-phenylethyl)pent-3-en-1-ynyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 143282503 |
| Molecular Formula | C29H28O3 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-methyl-2-[4-[(Z)-5-phenyl-3-(2-phenylethyl)pent-3-en-1-ynyl]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1ccc(C#C/C(=C\Cc2ccccc2)CCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H28O3/c1-29(2,28(30)31)32-27-21-19-26(20-22-27)18-17-25(15-13-23-9-5-3-6-10-23)16-14-24-11-7-4-8-12-24/h3-12,15,19-22H,13-14,16H2,1-2H3,(H,30,31)/b25-15- |
| InChIKey | OKDBPEFJGKUYNI-MYYYXRDXSA-N |
| XLogP | 6.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|