C26H35N3O4 — CID 89293723
2-[4-[3-[[amino(2-phenylethyl)carbamoyl]-propylamino]but-3-enyl]phenoxy]-2-methylpropanoic acid (PubChem CID 89293723) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 2-[4-[3-[[amino(2-phenylethyl)carbamoyl]-propylamino]but-3-enyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-[[amino(2-phenylethyl)carbamoyl]-propylamino]but-3-enyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 89293723 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 2-[4-[3-[[amino(2-phenylethyl)carbamoyl]-propylamino]but-3-enyl]phenoxy]-2-methylpropanoic acid |
| SMILES | C=C(CCc1ccc(OC(C)(C)C(=O)O)cc1)N(CCC)C(=O)N(N)CCc1ccccc1 |
| InChI | InChI=1S/C26H35N3O4/c1-5-18-28(25(32)29(27)19-17-21-9-7-6-8-10-21)20(2)11-12-22-13-15-23(16-14-22)33-26(3,4)24(30)31/h6-10,13-16H,2,5,11-12,17-19,27H2,1,3-4H3,(H,30,31) |
| InChIKey | SHNZGIVCIWKRRJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|