C27H37N3O4 — CID 89293737
2-[3-[4-[[amino-[(4-methylphenyl)methyl]carbamoyl]-propylamino]pent-4-enyl]phenoxy]-2-methylpropanoic acid (PubChem CID 89293737) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-[3-[4-[[amino-[(4-methylphenyl)methyl]carbamoyl]-propylamino]pent-4-enyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[4-[[amino-[(4-methylphenyl)methyl]carbamoyl]-propylamino]pent-4-enyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 89293737 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 2-[3-[4-[[amino-[(4-methylphenyl)methyl]carbamoyl]-propylamino]pent-4-enyl]phenoxy]-2-methylpropanoic acid |
| SMILES | C=C(CCCc1cccc(OC(C)(C)C(=O)O)c1)N(CCC)C(=O)N(N)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C27H37N3O4/c1-6-17-29(26(33)30(28)19-23-15-13-20(2)14-16-23)21(3)9-7-10-22-11-8-12-24(18-22)34-27(4,5)25(31)32/h8,11-16,18H,3,6-7,9-10,17,19,28H2,1-2,4-5H3,(H,31,32) |
| InChIKey | ACQMTHPIIQAZPA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|