C11H23N3O2S — CID 119985466
1-(aminomethyl)-2-[[cyclopropylmethyl(methyl)sulfamoyl]amino]cyclopentane (PubChem CID 119985466) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-(aminomethyl)-2-[[cyclopropylmethyl(methyl)sulfamoyl]amino]cyclopentane.
| Compound Name | 1-(aminomethyl)-2-[[cyclopropylmethyl(methyl)sulfamoyl]amino]cyclopentane |
|---|---|
| PubChem CID | 119985466 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(aminomethyl)-2-[[cyclopropylmethyl(methyl)sulfamoyl]amino]cyclopentane |
| SMILES | CN(CC1CC1)S(=O)(=O)NC1CCCC1CN |
| InChI | InChI=1S/C11H23N3O2S/c1-14(8-9-5-6-9)17(15,16)13-11-4-2-3-10(11)7-12/h9-11,13H,2-8,12H2,1H3 |
| InChIKey | QJHIPDDUHNDYHS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |