C11H26ClN3O2S — CID 119986092
1-(aminomethyl)-2-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane;hydrochloride (PubChem CID 119986092) has the molecular formula C11H26ClN3O2S and a molecular weight of 299.87 g/mol. Its IUPAC name is 1-(aminomethyl)-2-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane;hydrochloride.
| Compound Name | 1-(aminomethyl)-2-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane;hydrochloride |
|---|---|
| PubChem CID | 119986092 |
| Molecular Formula | C11H26ClN3O2S |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(aminomethyl)-2-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane;hydrochloride |
| SMILES | CC(C)N(C)S(=O)(=O)NC1CCCCC1CN.Cl |
| InChI | InChI=1S/C11H25N3O2S.ClH/c1-9(2)14(3)17(15,16)13-11-7-5-4-6-10(11)8-12;/h9-11,13H,4-8,12H2,1-3H3;1H |
| InChIKey | DROCGLQLTCDWTN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |