C12H26N2O2S — CID 119985622
N-[2-(aminomethyl)cyclopentyl]-2-ethylbutane-1-sulfonamide (PubChem CID 119985622) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-ethylbutane-1-sulfonamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-ethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 119985622 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-ethylbutane-1-sulfonamide |
| SMILES | CCC(CC)CS(=O)(=O)NC1CCCC1CN |
| InChI | InChI=1S/C12H26N2O2S/c1-3-10(4-2)9-17(15,16)14-12-7-5-6-11(12)8-13/h10-12,14H,3-9,13H2,1-2H3 |
| InChIKey | AYXWKZRGNPBOTK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |