C13H28ClN3O2S — CID 119985441
[[2-(aminomethyl)cyclopentyl]sulfamoyl-methylamino]cyclohexane;hydrochloride (PubChem CID 119985441) has the molecular formula C13H28ClN3O2S and a molecular weight of 325.91 g/mol. Its IUPAC name is [[2-(aminomethyl)cyclopentyl]sulfamoyl-methylamino]cyclohexane;hydrochloride.
| Compound Name | [[2-(aminomethyl)cyclopentyl]sulfamoyl-methylamino]cyclohexane;hydrochloride |
|---|---|
| PubChem CID | 119985441 |
| Molecular Formula | C13H28ClN3O2S |
| Molecular Weight | 325.91 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | [[2-(aminomethyl)cyclopentyl]sulfamoyl-methylamino]cyclohexane;hydrochloride |
| SMILES | CN(C1CCCCC1)S(=O)(=O)NC1CCCC1CN.Cl |
| InChI | InChI=1S/C13H27N3O2S.ClH/c1-16(12-7-3-2-4-8-12)19(17,18)15-13-9-5-6-11(13)10-14;/h11-13,15H,2-10,14H2,1H3;1H |
| InChIKey | YJNUCBZKYBTNMK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.91 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |