C16H18Br2NO5P — CID 11999783
[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]methylphosphonic acid (PubChem CID 11999783) has the molecular formula C16H18Br2NO5P and a molecular weight of 495.10 g/mol. Its IUPAC name is [3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]methylphosphonic acid.
| Compound Name | [3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]methylphosphonic acid |
|---|---|
| PubChem CID | 11999783 |
| Molecular Formula | C16H18Br2NO5P |
| Molecular Weight | 495.10 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | [3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]methylphosphonic acid |
| SMILES | CC(C)c1cc(Oc2c(Br)cc(NCP(=O)(O)O)cc2Br)ccc1O |
| InChI | InChI=1S/C16H18Br2NO5P/c1-9(2)12-7-11(3-4-15(12)20)24-16-13(17)5-10(6-14(16)18)19-8-25(21,22)23/h3-7,9,19-20H,8H2,1-2H3,(H2,21,22,23) |
| InChIKey | YZCJJTBDQXIRJA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.10 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|