C19H16F3NO2S — CID 12001119
S-ethyl 2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline-3-carbothioate (PubChem CID 12001119) has the molecular formula C19H16F3NO2S and a molecular weight of 379.40 g/mol. Its IUPAC name is S-ethyl 2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline-3-carbothioate.
| Compound Name | S-ethyl 2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline-3-carbothioate |
|---|---|
| PubChem CID | 12001119 |
| Molecular Formula | C19H16F3NO2S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | S-ethyl 2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline-3-carbothioate |
| SMILES | CCSC(=O)C1Cc2cc(-c3ccc(C(F)(F)F)cc3)ccc2NC1=O |
| InChI | InChI=1S/C19H16F3NO2S/c1-2-26-18(25)15-10-13-9-12(5-8-16(13)23-17(15)24)11-3-6-14(7-4-11)19(20,21)22/h3-9,15H,2,10H2,1H3,(H,23,24) |
| InChIKey | HIEYYJJYHZGHCO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|