C13H15NO3 — CID 114553163
2-oxo-6-propyl-3,4-dihydro-1H-quinoline-3-carboxylic acid (PubChem CID 114553163) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-oxo-6-propyl-3,4-dihydro-1H-quinoline-3-carboxylic acid.
| Compound Name | 2-oxo-6-propyl-3,4-dihydro-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 114553163 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-oxo-6-propyl-3,4-dihydro-1H-quinoline-3-carboxylic acid |
| SMILES | CCCc1ccc2c(c1)CC(C(=O)O)C(=O)N2 |
| InChI | InChI=1S/C13H15NO3/c1-2-3-8-4-5-11-9(6-8)7-10(13(16)17)12(15)14-11/h4-6,10H,2-3,7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | CKFZXOKUJQHTGD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|