sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate

C10H7FNNaO3 — CID 126796897

IUPACsodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate
SMILESO=C([O-])C1Cc2cc(F)ccc2NC1=O.[Na+]
InChIInChI=1S/C10H8FNO3.Na/c11-6-1-2-8-5(3-6)4-7(10(14)15)9(13)12-8;/h1-3,7H,4H2,(H,12,13)(H,14,15);/q;+1/p-1
InChIKeyQZYGQKHLJZQURQ-UHFFFAOYSA-M
MW231.16 g/mol
LogP-3.31
Rot. Bonds1

About sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate

sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate (PubChem CID 126796897) has the molecular formula C10H7FNNaO3 and a molecular weight of 231.16 g/mol. Its IUPAC name is sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate.

Molecular Properties

Compound Namesodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate
PubChem CID126796897
Molecular FormulaC10H7FNNaO3
Molecular Weight231.16 g/mol
Exact Mass231.03
IUPAC Namesodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate
SMILESO=C([O-])C1Cc2cc(F)ccc2NC1=O.[Na+]
InChIInChI=1S/C10H8FNO3.Na/c11-6-1-2-8-5(3-6)4-7(10(14)15)9(13)12-8;/h1-3,7H,4H2,(H,12,13)(H,14,15);/q;+1/p-1
InChIKeyQZYGQKHLJZQURQ-UHFFFAOYSA-M
XLogP-3.31
TPSA69.23 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.16
LogP ≤ 5-3.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
The IUPAC name of sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate (CID 126796897) is sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate.
What is the SMILES notation for sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
The canonical SMILES for sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate is O=C([O-])C1Cc2cc(F)ccc2NC1=O.[Na+].
What is the InChIKey of sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
The InChIKey is QZYGQKHLJZQURQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8FNO3.Na/c11-6-1-2-8-5(3-6)4-7(10(14)15)9(13)12-8;/h1-3,7H,4H2,(H,12,13)(H,14,15);/q;+1/p-1.
What are the key properties of sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate has a molecular weight of 231.16 g/mol, XLogP of -3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate is sourced from PubChem (CID 126796897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).