C20H26ClNO4S — CID 12003887
4-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 12003887) has the molecular formula C20H26ClNO4S and a molecular weight of 411.95 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 12003887 |
| Molecular Formula | C20H26ClNO4S |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)CC[C@@H]1/C=C/[C@@H](O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H26ClNO4S/c21-16-4-1-3-15(13-16)14-18(23)8-6-17-7-9-19(24)22(17)10-12-27-11-2-5-20(25)26/h1,3-4,6,8,13,17-18,23H,2,5,7,9-12,14H2,(H,25,26)/b8-6+/t17-,18+/m0/s1 |
| InChIKey | ZEQIDWZOBUPIGE-JFDVKVQISA-N |
| XLogP | 3.39 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|