C8H15Cl2NO2 — CID 12003943
methyl (2S,4S)-5,5-dichloro-4-methyl-2-(methylamino)pentanoate (PubChem CID 12003943) has the molecular formula C8H15Cl2NO2 and a molecular weight of 228.12 g/mol. Its IUPAC name is methyl (2S,4S)-5,5-dichloro-4-methyl-2-(methylamino)pentanoate.
| Compound Name | methyl (2S,4S)-5,5-dichloro-4-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 12003943 |
| Molecular Formula | C8H15Cl2NO2 |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | methyl (2S,4S)-5,5-dichloro-4-methyl-2-(methylamino)pentanoate |
| SMILES | CN[C@@H](C[C@H](C)C(Cl)Cl)C(=O)OC |
| InChI | InChI=1S/C8H15Cl2NO2/c1-5(7(9)10)4-6(11-2)8(12)13-3/h5-7,11H,4H2,1-3H3/t5-,6-/m0/s1 |
| InChIKey | PQINMHDJDGNBPT-WDSKDSINSA-N |
| XLogP | 1.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|