C22H15ClN2O2S — CID 12004221
3-(1,3-benzothiazol-6-yl)-1-[(4-chlorophenyl)methyl]-3-hydroxyindol-2-one (PubChem CID 12004221) has the molecular formula C22H15ClN2O2S and a molecular weight of 406.89 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)-1-[(4-chlorophenyl)methyl]-3-hydroxyindol-2-one.
| Compound Name | 3-(1,3-benzothiazol-6-yl)-1-[(4-chlorophenyl)methyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 12004221 |
| Molecular Formula | C22H15ClN2O2S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)-1-[(4-chlorophenyl)methyl]-3-hydroxyindol-2-one |
| SMILES | O=C1N(Cc2ccc(Cl)cc2)c2ccccc2C1(O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C22H15ClN2O2S/c23-16-8-5-14(6-9-16)12-25-19-4-2-1-3-17(19)22(27,21(25)26)15-7-10-18-20(11-15)28-13-24-18/h1-11,13,27H,12H2 |
| InChIKey | MWHLHYVISJCGGL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |