C18H16BrN3OS — CID 12006267
6-methoxy-3-(quinolin-8-ylmethyl)-1,3-benzothiazol-3-ium-2-amine bromide (PubChem CID 12006267) has the molecular formula C18H16BrN3OS and a molecular weight of 402.32 g/mol. Its IUPAC name is 6-methoxy-3-(quinolin-8-ylmethyl)-1,3-benzothiazol-3-ium-2-amine bromide.
| Compound Name | 6-methoxy-3-(quinolin-8-ylmethyl)-1,3-benzothiazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 12006267 |
| Molecular Formula | C18H16BrN3OS |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 6-methoxy-3-(quinolin-8-ylmethyl)-1,3-benzothiazol-3-ium-2-amine bromide |
| SMILES | COc1ccc2c(c1)sc(N)[n+]2Cc1cccc2cccnc12.[Br-] |
| InChI | InChI=1S/C18H15N3OS.BrH/c1-22-14-7-8-15-16(10-14)23-18(19)21(15)11-13-5-2-4-12-6-3-9-20-17(12)13;/h2-10,19H,11H2,1H3;1H |
| InChIKey | WEVNGTVNNVVTSN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|