C18H18O2 — CID 12013689
[(2S,4R,6R)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanol (PubChem CID 12013689) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(2S,4R,6R)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanol.
| Compound Name | [(2S,4R,6R)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanol |
|---|---|
| PubChem CID | 12013689 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [(2S,4R,6R)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanol |
| SMILES | OC[C@H]1C[C@@H]2c3ccccc3Cc3ccccc3[C@H]2O1 |
| InChI | InChI=1S/C18H18O2/c19-11-14-10-17-15-7-3-1-5-12(15)9-13-6-2-4-8-16(13)18(17)20-14/h1-8,14,17-19H,9-11H2/t14-,17-,18-/m1/s1 |
| InChIKey | MGQYFVXZHSAQFR-ZTFGCOKTSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |