C12H19NO — CID 12015140
(3E)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile (PubChem CID 12015140) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3E)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile.
| Compound Name | (3E)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile |
|---|---|
| PubChem CID | 12015140 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3E)-3-(2-hydroxy-2,6,6-trimethylcyclohexylidene)propanenitrile |
| SMILES | CC1(C)CCCC(C)(O)/C1=C/CC#N |
| InChI | InChI=1S/C12H19NO/c1-11(2)7-5-8-12(3,14)10(11)6-4-9-13/h6,14H,4-5,7-8H2,1-3H3/b10-6+ |
| InChIKey | MBRKZCGOVKMALA-UXBLZVDNSA-N |
| XLogP | 2.79 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|